C20H26N6O2 — CID 59648315
8-[6-(cyclopropylmethylamino)-3-pyridinyl]-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 59648315) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 8-[6-(cyclopropylmethylamino)-3-pyridinyl]-1,3-dipropyl-7H-purine-2,6-dione.
| Compound Name | 8-[6-(cyclopropylmethylamino)-3-pyridinyl]-1,3-dipropyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 59648315 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 8-[6-(cyclopropylmethylamino)-3-pyridinyl]-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(-c3ccc(NCC4CC4)nc3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C20H26N6O2/c1-3-9-25-18-16(19(27)26(10-4-2)20(25)28)23-17(24-18)14-7-8-15(22-12-14)21-11-13-5-6-13/h7-8,12-13H,3-6,9-11H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | YWJREELZTQMSJI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |