C21H28N6O2 — CID 67054307
8-[6-(cyclopentylamino)-3-pyridinyl]-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 67054307) has the molecular formula C21H28N6O2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 8-[6-(cyclopentylamino)-3-pyridinyl]-1,3-dipropyl-7H-purine-2,6-dione.
| Compound Name | 8-[6-(cyclopentylamino)-3-pyridinyl]-1,3-dipropyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 67054307 |
| Molecular Formula | C21H28N6O2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 8-[6-(cyclopentylamino)-3-pyridinyl]-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(-c3ccc(NC4CCCC4)nc3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C21H28N6O2/c1-3-11-26-19-17(20(28)27(12-4-2)21(26)29)24-18(25-19)14-9-10-16(22-13-14)23-15-7-5-6-8-15/h9-10,13,15H,3-8,11-12H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | OFMGPQKZHNIOPM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |