C16H22N8O2 — CID 174665566
1,3-bis(ethylamino)-8-[6-(ethylamino)-3-pyridinyl]-7H-purine-2,6-dione (PubChem CID 174665566) has the molecular formula C16H22N8O2 and a molecular weight of 358.41 g/mol. Its IUPAC name is 1,3-bis(ethylamino)-8-[6-(ethylamino)-3-pyridinyl]-7H-purine-2,6-dione.
| Compound Name | 1,3-bis(ethylamino)-8-[6-(ethylamino)-3-pyridinyl]-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 174665566 |
| Molecular Formula | C16H22N8O2 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 1,3-bis(ethylamino)-8-[6-(ethylamino)-3-pyridinyl]-7H-purine-2,6-dione |
| SMILES | CCNc1ccc(-c2nc3c([nH]2)c(=O)n(NCC)c(=O)n3NCC)cn1 |
| InChI | InChI=1S/C16H22N8O2/c1-4-17-11-8-7-10(9-18-11)13-21-12-14(22-13)23(19-5-2)16(26)24(15(12)25)20-6-3/h7-9,19-20H,4-6H2,1-3H3,(H,17,18)(H,21,22) |
| InChIKey | JQCWREXMELUVKK-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 121.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |