C12H10ClN5O2 — CID 147125697
8-(6-chloro-3-pyridinyl)-3-ethyl-7H-purine-2,6-dione (PubChem CID 147125697) has the molecular formula C12H10ClN5O2 and a molecular weight of 291.70 g/mol. Its IUPAC name is 8-(6-chloro-3-pyridinyl)-3-ethyl-7H-purine-2,6-dione.
| Compound Name | 8-(6-chloro-3-pyridinyl)-3-ethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 147125697 |
| Molecular Formula | C12H10ClN5O2 |
| Molecular Weight | 291.70 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 8-(6-chloro-3-pyridinyl)-3-ethyl-7H-purine-2,6-dione |
| SMILES | CCn1c(=O)[nH]c(=O)c2[nH]c(-c3ccc(Cl)nc3)nc21 |
| InChI | InChI=1S/C12H10ClN5O2/c1-2-18-10-8(11(19)17-12(18)20)15-9(16-10)6-3-4-7(13)14-5-6/h3-5H,2H2,1H3,(H,15,16)(H,17,19,20) |
| InChIKey | BPFPWNOWMWPALN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.70 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|