C13H13N5O2 — CID 115925584
3-ethyl-8-(6-methyl-3-pyridinyl)-7H-purine-2,6-dione (PubChem CID 115925584) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is 3-ethyl-8-(6-methyl-3-pyridinyl)-7H-purine-2,6-dione.
| Compound Name | 3-ethyl-8-(6-methyl-3-pyridinyl)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 115925584 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 3-ethyl-8-(6-methyl-3-pyridinyl)-7H-purine-2,6-dione |
| SMILES | CCn1c(=O)[nH]c(=O)c2[nH]c(-c3ccc(C)nc3)nc21 |
| InChI | InChI=1S/C13H13N5O2/c1-3-18-11-9(12(19)17-13(18)20)15-10(16-11)8-5-4-7(2)14-6-8/h4-6H,3H2,1-2H3,(H,15,16)(H,17,19,20) |
| InChIKey | WRTUKTSJEBNUHA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |