C14H13BrN4O2 — CID 115877858
8-(3-bromo-4-methylphenyl)-3-ethyl-7H-purine-2,6-dione (PubChem CID 115877858) has the molecular formula C14H13BrN4O2 and a molecular weight of 349.19 g/mol. Its IUPAC name is 8-(3-bromo-4-methylphenyl)-3-ethyl-7H-purine-2,6-dione.
| Compound Name | 8-(3-bromo-4-methylphenyl)-3-ethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 115877858 |
| Molecular Formula | C14H13BrN4O2 |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 8-(3-bromo-4-methylphenyl)-3-ethyl-7H-purine-2,6-dione |
| SMILES | CCn1c(=O)[nH]c(=O)c2[nH]c(-c3ccc(C)c(Br)c3)nc21 |
| InChI | InChI=1S/C14H13BrN4O2/c1-3-19-12-10(13(20)18-14(19)21)16-11(17-12)8-5-4-7(2)9(15)6-8/h4-6H,3H2,1-2H3,(H,16,17)(H,18,20,21) |
| InChIKey | OBJZADVRFMBRRP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |