C19H15ClFN5O2 — CID 148608207
8-(6-chloro-3-pyridinyl)-3-ethyl-7-[(4-fluorophenyl)methyl]purine-2,6-dione (PubChem CID 148608207) has the molecular formula C19H15ClFN5O2 and a molecular weight of 399.81 g/mol. Its IUPAC name is 8-(6-chloro-3-pyridinyl)-3-ethyl-7-[(4-fluorophenyl)methyl]purine-2,6-dione.
| Compound Name | 8-(6-chloro-3-pyridinyl)-3-ethyl-7-[(4-fluorophenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 148608207 |
| Molecular Formula | C19H15ClFN5O2 |
| Molecular Weight | 399.81 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 8-(6-chloro-3-pyridinyl)-3-ethyl-7-[(4-fluorophenyl)methyl]purine-2,6-dione |
| SMILES | CCn1c(=O)[nH]c(=O)c2c1nc(-c1ccc(Cl)nc1)n2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H15ClFN5O2/c1-2-25-17-15(18(27)24-19(25)28)26(10-11-3-6-13(21)7-4-11)16(23-17)12-5-8-14(20)22-9-12/h3-9H,2,10H2,1H3,(H,24,27,28) |
| InChIKey | NDVRYEVPDKQCLH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.81 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|