About 3-ethyl-7-methyl-8-thieno[3,2-b]pyridin-6-ylpurine-2,6-dione
3-ethyl-7-methyl-8-thieno[3,2-b]pyridin-6-ylpurine-2,6-dione (PubChem CID 71910015) has the molecular formula C15H13N5O2S
and a molecular weight of 327.37 g/mol. Its IUPAC name is 3-ethyl-7-methyl-8-thieno[3,2-b]pyridin-6-ylpurine-2,6-dione.
Molecular Properties
| Compound Name | 3-ethyl-7-methyl-8-thieno[3,2-b]pyridin-6-ylpurine-2,6-dione |
| PubChem CID | 71910015 |
| Molecular Formula | C15H13N5O2S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 3-ethyl-7-methyl-8-thieno[3,2-b]pyridin-6-ylpurine-2,6-dione |
| SMILES | CCn1c(=O)[nH]c(=O)c2c1nc(-c1cnc3ccsc3c1)n2C |
| InChI | InChI=1S/C15H13N5O2S/c1-3-20-13-11(14(21)18-15(20)22)19(2)12(17-13)8-6-10-9(16-7-8)4-5-23-10/h4-7H,3H2,1-2H3,(H,18,21,22) |
| InChIKey | NNCYJBJAAYIMJW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-ethyl-7-methyl-8-thieno[3,2-b]pyridin-6-ylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-7-methyl-8-thieno[3,2-b]pyridin-6-ylpurine-2,6-dione?
The IUPAC name of 3-ethyl-7-methyl-8-thieno[3,2-b]pyridin-6-ylpurine-2,6-dione (CID 71910015) is 3-ethyl-7-methyl-8-thieno[3,2-b]pyridin-6-ylpurine-2,6-dione.
What is the SMILES notation for 3-ethyl-7-methyl-8-thieno[3,2-b]pyridin-6-ylpurine-2,6-dione?
The canonical SMILES for 3-ethyl-7-methyl-8-thieno[3,2-b]pyridin-6-ylpurine-2,6-dione is CCn1c(=O)[nH]c(=O)c2c1nc(-c1cnc3ccsc3c1)n2C.
What is the InChIKey of 3-ethyl-7-methyl-8-thieno[3,2-b]pyridin-6-ylpurine-2,6-dione?
The InChIKey is NNCYJBJAAYIMJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N5O2S/c1-3-20-13-11(14(21)18-15(20)22)19(2)12(17-13)8-6-10-9(16-7-8)4-5-23-10/h4-7H,3H2,1-2H3,(H,18,21,22).
What are the key properties of 3-ethyl-7-methyl-8-thieno[3,2-b]pyridin-6-ylpurine-2,6-dione?
3-ethyl-7-methyl-8-thieno[3,2-b]pyridin-6-ylpurine-2,6-dione has a molecular weight of 327.37 g/mol, XLogP of 1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-7-methyl-8-thieno[3,2-b]pyridin-6-ylpurine-2,6-dione is sourced from PubChem (CID 71910015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).