C18H23N7O3 — CID 52672405
3-butyl-7-methyl-8-(2-morpholin-4-ylpyrimidin-5-yl)purine-2,6-dione (PubChem CID 52672405) has the molecular formula C18H23N7O3 and a molecular weight of 385.43 g/mol. Its IUPAC name is 3-butyl-7-methyl-8-(2-morpholin-4-ylpyrimidin-5-yl)purine-2,6-dione.
| Compound Name | 3-butyl-7-methyl-8-(2-morpholin-4-ylpyrimidin-5-yl)purine-2,6-dione |
|---|---|
| PubChem CID | 52672405 |
| Molecular Formula | C18H23N7O3 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 3-butyl-7-methyl-8-(2-morpholin-4-ylpyrimidin-5-yl)purine-2,6-dione |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(-c1cnc(N3CCOCC3)nc1)n2C |
| InChI | InChI=1S/C18H23N7O3/c1-3-4-5-25-15-13(16(26)22-18(25)27)23(2)14(21-15)12-10-19-17(20-11-12)24-6-8-28-9-7-24/h10-11H,3-9H2,1-2H3,(H,22,26,27) |
| InChIKey | POLYUKIUAGUBMW-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |