C19H24N6O3 — CID 4830043
7-(2-morpholin-4-ylethyl)-3-propyl-8-pyridin-4-ylpurine-2,6-dione (PubChem CID 4830043) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 7-(2-morpholin-4-ylethyl)-3-propyl-8-pyridin-4-ylpurine-2,6-dione.
| Compound Name | 7-(2-morpholin-4-ylethyl)-3-propyl-8-pyridin-4-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 4830043 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 7-(2-morpholin-4-ylethyl)-3-propyl-8-pyridin-4-ylpurine-2,6-dione |
| SMILES | CCCn1c(=O)[nH]c(=O)c2c1nc(-c1ccncc1)n2CCN1CCOCC1 |
| InChI | InChI=1S/C19H24N6O3/c1-2-7-25-17-15(18(26)22-19(25)27)24(9-8-23-10-12-28-13-11-23)16(21-17)14-3-5-20-6-4-14/h3-6H,2,7-13H2,1H3,(H,22,26,27) |
| InChIKey | PYPSETCRFXJOMW-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 98.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |