C21H25N5O4 — CID 97357650
(3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl (Z)-3-pyridin-4-ylprop-2-enoate (PubChem CID 97357650) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl (Z)-3-pyridin-4-ylprop-2-enoate.
| Compound Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl (Z)-3-pyridin-4-ylprop-2-enoate |
|---|---|
| PubChem CID | 97357650 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl (Z)-3-pyridin-4-ylprop-2-enoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)/C=C\c1ccncc1)n2CCC |
| InChI | InChI=1S/C21H25N5O4/c1-3-5-13-26-19-18(20(28)24-21(26)29)25(12-4-2)16(23-19)14-30-17(27)7-6-15-8-10-22-11-9-15/h6-11H,3-5,12-14H2,1-2H3,(H,24,28,29)/b7-6- |
| InChIKey | FAQADBNIBYGRNB-SREVYHEPSA-N |
| XLogP | 2.25 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|