C21H26N4O5S — CID 75362756
(3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl (E)-3-(furan-2-ylmethylsulfanyl)prop-2-enoate (PubChem CID 75362756) has the molecular formula C21H26N4O5S and a molecular weight of 446.53 g/mol. Its IUPAC name is (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl (E)-3-(furan-2-ylmethylsulfanyl)prop-2-enoate.
| Compound Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl (E)-3-(furan-2-ylmethylsulfanyl)prop-2-enoate |
|---|---|
| PubChem CID | 75362756 |
| Molecular Formula | C21H26N4O5S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl (E)-3-(furan-2-ylmethylsulfanyl)prop-2-enoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)/C=C/SCc1ccco1)n2CCC |
| InChI | InChI=1S/C21H26N4O5S/c1-3-5-10-25-19-18(20(27)23-21(25)28)24(9-4-2)16(22-19)13-30-17(26)8-12-31-14-15-7-6-11-29-15/h6-8,11-12H,3-5,9-10,13-14H2,1-2H3,(H,23,27,28)/b12-8+ |
| InChIKey | YEWHKXQVXORPOL-XYOKQWHBSA-N |
| XLogP | 3.18 |
| TPSA | 112.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|