C22H26N4O5 — CID 46827900
(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl (E)-3-(3-methoxyphenyl)prop-2-enoate (PubChem CID 46827900) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl (E)-3-(3-methoxyphenyl)prop-2-enoate.
| Compound Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl (E)-3-(3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 46827900 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl (E)-3-(3-methoxyphenyl)prop-2-enoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)/C=C/c1cccc(OC)c1)n2CC |
| InChI | InChI=1S/C22H26N4O5/c1-4-6-12-26-20-19(21(28)24-22(26)29)25(5-2)17(23-20)14-31-18(27)11-10-15-8-7-9-16(13-15)30-3/h7-11,13H,4-6,12,14H2,1-3H3,(H,24,28,29)/b11-10+ |
| InChIKey | WNWRGZDFAIAMAU-ZHACJKMWSA-N |
| XLogP | 2.47 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|