C20H23N5O6 — CID 55459593
(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 2-methyl-6-nitrobenzoate (PubChem CID 55459593) has the molecular formula C20H23N5O6 and a molecular weight of 429.43 g/mol. Its IUPAC name is (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 2-methyl-6-nitrobenzoate.
| Compound Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 2-methyl-6-nitrobenzoate |
|---|---|
| PubChem CID | 55459593 |
| Molecular Formula | C20H23N5O6 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 2-methyl-6-nitrobenzoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)c1c(C)cccc1[N+](=O)[O-])n2CC |
| InChI | InChI=1S/C20H23N5O6/c1-4-6-10-24-17-16(18(26)22-20(24)28)23(5-2)14(21-17)11-31-19(27)15-12(3)8-7-9-13(15)25(29)30/h7-9H,4-6,10-11H2,1-3H3,(H,22,26,28) |
| InChIKey | AHSLHGRUXVEVFI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 142.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|