C21H27N5O4 — CID 7506606
(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-(dimethylamino)benzoate (PubChem CID 7506606) has the molecular formula C21H27N5O4 and a molecular weight of 413.48 g/mol. Its IUPAC name is (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-(dimethylamino)benzoate.
| Compound Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 7506606 |
| Molecular Formula | C21H27N5O4 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-(dimethylamino)benzoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)c1cccc(N(C)C)c1)n2CC |
| InChI | InChI=1S/C21H27N5O4/c1-5-7-11-26-18-17(19(27)23-21(26)29)25(6-2)16(22-18)13-30-20(28)14-9-8-10-15(12-14)24(3)4/h8-10,12H,5-7,11,13H2,1-4H3,(H,23,27,29) |
| InChIKey | NFRPQGOLNZBINZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |