C20H23BrN4O5 — CID 6211981
(3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 6211981) has the molecular formula C20H23BrN4O5 and a molecular weight of 479.33 g/mol. Its IUPAC name is (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 6211981 |
| Molecular Formula | C20H23BrN4O5 |
| Molecular Weight | 479.33 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)/C=C/c1ccc(Br)o1)n2CCC |
| InChI | InChI=1S/C20H23BrN4O5/c1-3-5-11-25-18-17(19(27)23-20(25)28)24(10-4-2)15(22-18)12-29-16(26)9-7-13-6-8-14(21)30-13/h6-9H,3-5,10-12H2,1-2H3,(H,23,27,28)/b9-7+ |
| InChIKey | VVFQPLMQUGFHBJ-VQHVLOKHSA-N |
| XLogP | 3.21 |
| TPSA | 112.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|