C24H30N4O4 — CID 97098666
(3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl (3S)-3-phenylpent-4-enoate (PubChem CID 97098666) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl (3S)-3-phenylpent-4-enoate.
| Compound Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl (3S)-3-phenylpent-4-enoate |
|---|---|
| PubChem CID | 97098666 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl (3S)-3-phenylpent-4-enoate |
| SMILES | C=C[C@H](CC(=O)OCc1nc2c(c(=O)[nH]c(=O)n2CCCC)n1CCC)c1ccccc1 |
| InChI | InChI=1S/C24H30N4O4/c1-4-7-14-28-22-21(23(30)26-24(28)31)27(13-5-2)19(25-22)16-32-20(29)15-17(6-3)18-11-9-8-10-12-18/h6,8-12,17H,3-5,7,13-16H2,1-2H3,(H,26,30,31)/t17-/m1/s1 |
| InChIKey | BTGNEQRZQLXURD-QGZVFWFLSA-N |
| XLogP | 3.50 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|