C23H25N5O5 — CID 5013899
(3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 2-oxo-1H-quinoline-4-carboxylate (PubChem CID 5013899) has the molecular formula C23H25N5O5 and a molecular weight of 451.48 g/mol. Its IUPAC name is (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 2-oxo-1H-quinoline-4-carboxylate.
| Compound Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 2-oxo-1H-quinoline-4-carboxylate |
|---|---|
| PubChem CID | 5013899 |
| Molecular Formula | C23H25N5O5 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 2-oxo-1H-quinoline-4-carboxylate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)c1cc(=O)[nH]c3ccccc13)n2CCC |
| InChI | InChI=1S/C23H25N5O5/c1-3-5-11-28-20-19(21(30)26-23(28)32)27(10-4-2)17(25-20)13-33-22(31)15-12-18(29)24-16-9-7-6-8-14(15)16/h6-9,12H,3-5,10-11,13H2,1-2H3,(H,24,29)(H,26,30,32) |
| InChIKey | JSLZGLFBDVTTHM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 131.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |