C24H32N4O5 — CID 55640484
(3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 2-(3-propan-2-ylphenoxy)acetate (PubChem CID 55640484) has the molecular formula C24H32N4O5 and a molecular weight of 456.54 g/mol. Its IUPAC name is (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 2-(3-propan-2-ylphenoxy)acetate.
| Compound Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 2-(3-propan-2-ylphenoxy)acetate |
|---|---|
| PubChem CID | 55640484 |
| Molecular Formula | C24H32N4O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | (3-butyl-2,6-dioxo-7-propylpurin-8-yl)methyl 2-(3-propan-2-ylphenoxy)acetate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)COc1cccc(C(C)C)c1)n2CCC |
| InChI | InChI=1S/C24H32N4O5/c1-5-7-12-28-22-21(23(30)26-24(28)31)27(11-6-2)19(25-22)14-33-20(29)15-32-18-10-8-9-17(13-18)16(3)4/h8-10,13,16H,5-7,11-12,14-15H2,1-4H3,(H,26,30,31) |
| InChIKey | YNSXJEKXOWJWCG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |