C12H18N6O3 — CID 66485145
8-amino-3-methyl-7-(2-morpholin-4-ylethyl)purine-2,6-dione (PubChem CID 66485145) has the molecular formula C12H18N6O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 8-amino-3-methyl-7-(2-morpholin-4-ylethyl)purine-2,6-dione.
| Compound Name | 8-amino-3-methyl-7-(2-morpholin-4-ylethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 66485145 |
| Molecular Formula | C12H18N6O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 8-amino-3-methyl-7-(2-morpholin-4-ylethyl)purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(N)n2CCN1CCOCC1 |
| InChI | InChI=1S/C12H18N6O3/c1-16-9-8(10(19)15-12(16)20)18(11(13)14-9)3-2-17-4-6-21-7-5-17/h2-7H2,1H3,(H2,13,14)(H,15,19,20) |
| InChIKey | ONLFEODDTLRUAH-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |