C14H22N6O2 — CID 82463977
7-ethyl-3-methyl-8-(2-piperazin-1-ylethyl)purine-2,6-dione (PubChem CID 82463977) has the molecular formula C14H22N6O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 7-ethyl-3-methyl-8-(2-piperazin-1-ylethyl)purine-2,6-dione.
| Compound Name | 7-ethyl-3-methyl-8-(2-piperazin-1-ylethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 82463977 |
| Molecular Formula | C14H22N6O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 7-ethyl-3-methyl-8-(2-piperazin-1-ylethyl)purine-2,6-dione |
| SMILES | CCn1c(CCN2CCNCC2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C14H22N6O2/c1-3-20-10(4-7-19-8-5-15-6-9-19)16-12-11(20)13(21)17-14(22)18(12)2/h15H,3-9H2,1-2H3,(H,17,21,22) |
| InChIKey | AKJGYIBDOXYTIT-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |