C15H25N5O2 — CID 7137080
8-[(dipropylamino)methyl]-7-ethyl-3-methylpurine-2,6-dione (PubChem CID 7137080) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 8-[(dipropylamino)methyl]-7-ethyl-3-methylpurine-2,6-dione.
| Compound Name | 8-[(dipropylamino)methyl]-7-ethyl-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 7137080 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 8-[(dipropylamino)methyl]-7-ethyl-3-methylpurine-2,6-dione |
| SMILES | CCCN(CCC)Cc1nc2c(c(=O)[nH]c(=O)n2C)n1CC |
| InChI | InChI=1S/C15H25N5O2/c1-5-8-19(9-6-2)10-11-16-13-12(20(11)7-3)14(21)17-15(22)18(13)4/h5-10H2,1-4H3,(H,17,21,22) |
| InChIKey | BBBTVFXETZLMLK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 75.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |