C18H31N5O2 — CID 3097485
8-(dipentylamino)-7-ethyl-3-methylpurine-2,6-dione (PubChem CID 3097485) has the molecular formula C18H31N5O2 and a molecular weight of 349.48 g/mol. Its IUPAC name is 8-(dipentylamino)-7-ethyl-3-methylpurine-2,6-dione.
| Compound Name | 8-(dipentylamino)-7-ethyl-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 3097485 |
| Molecular Formula | C18H31N5O2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | 8-(dipentylamino)-7-ethyl-3-methylpurine-2,6-dione |
| SMILES | CCCCCN(CCCCC)c1nc2c(c(=O)[nH]c(=O)n2C)n1CC |
| InChI | InChI=1S/C18H31N5O2/c1-5-8-10-12-22(13-11-9-6-2)17-19-15-14(23(17)7-3)16(24)20-18(25)21(15)4/h5-13H2,1-4H3,(H,20,24,25) |
| InChIKey | DUUXWOMDRYVEJJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 75.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|