C16H27N5O2 — CID 3097484
8-(dibutylamino)-7-ethyl-3-methylpurine-2,6-dione (PubChem CID 3097484) has the molecular formula C16H27N5O2 and a molecular weight of 321.43 g/mol. Its IUPAC name is 8-(dibutylamino)-7-ethyl-3-methylpurine-2,6-dione.
| Compound Name | 8-(dibutylamino)-7-ethyl-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 3097484 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 8-(dibutylamino)-7-ethyl-3-methylpurine-2,6-dione |
| SMILES | CCCCN(CCCC)c1nc2c(c(=O)[nH]c(=O)n2C)n1CC |
| InChI | InChI=1S/C16H27N5O2/c1-5-8-10-20(11-9-6-2)15-17-13-12(21(15)7-3)14(22)18-16(23)19(13)4/h5-11H2,1-4H3,(H,18,22,23) |
| InChIKey | VTPWYAKUKBELNM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 75.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |