C14H20ClN5O2 — CID 71962088
7-(3-chlorobut-2-enyl)-8-(diethylamino)-3-methylpurine-2,6-dione (PubChem CID 71962088) has the molecular formula C14H20ClN5O2 and a molecular weight of 325.80 g/mol. Its IUPAC name is 7-(3-chlorobut-2-enyl)-8-(diethylamino)-3-methylpurine-2,6-dione.
| Compound Name | 7-(3-chlorobut-2-enyl)-8-(diethylamino)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 71962088 |
| Molecular Formula | C14H20ClN5O2 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 7-(3-chlorobut-2-enyl)-8-(diethylamino)-3-methylpurine-2,6-dione |
| SMILES | CCN(CC)c1nc2c(c(=O)[nH]c(=O)n2C)n1CC=C(C)Cl |
| InChI | InChI=1S/C14H20ClN5O2/c1-5-19(6-2)13-16-11-10(20(13)8-7-9(3)15)12(21)17-14(22)18(11)4/h7H,5-6,8H2,1-4H3,(H,17,21,22) |
| InChIKey | WEIUXXAGQBIRSG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 75.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |