C19H29N5O5 — CID 7137268
ethyl (2R)-2-[8-[(dipropylamino)methyl]-3-methyl-2,6-dioxopurin-7-yl]-3-oxobutanoate (PubChem CID 7137268) has the molecular formula C19H29N5O5 and a molecular weight of 407.47 g/mol. Its IUPAC name is ethyl (2R)-2-[8-[(dipropylamino)methyl]-3-methyl-2,6-dioxopurin-7-yl]-3-oxobutanoate.
| Compound Name | ethyl (2R)-2-[8-[(dipropylamino)methyl]-3-methyl-2,6-dioxopurin-7-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 7137268 |
| Molecular Formula | C19H29N5O5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | ethyl (2R)-2-[8-[(dipropylamino)methyl]-3-methyl-2,6-dioxopurin-7-yl]-3-oxobutanoate |
| SMILES | CCCN(CCC)Cc1nc2c(c(=O)[nH]c(=O)n2C)n1[C@H](C(C)=O)C(=O)OCC |
| InChI | InChI=1S/C19H29N5O5/c1-6-9-23(10-7-2)11-13-20-16-15(17(26)21-19(28)22(16)5)24(13)14(12(4)25)18(27)29-8-3/h14H,6-11H2,1-5H3,(H,21,26,28)/t14-/m1/s1 |
| InChIKey | TXHMCHJLIYOQJE-CQSZACIVSA-N |
| XLogP | 0.74 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|