C14H22N5O3+ — CID 4569857
3-methyl-8-(morpholin-4-ium-4-ylmethyl)-7-propylpurine-2,6-dione (PubChem CID 4569857) has the molecular formula C14H22N5O3+ and a molecular weight of 308.36 g/mol. Its IUPAC name is 3-methyl-8-(morpholin-4-ium-4-ylmethyl)-7-propylpurine-2,6-dione.
| Compound Name | 3-methyl-8-(morpholin-4-ium-4-ylmethyl)-7-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 4569857 |
| Molecular Formula | C14H22N5O3+ |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 3-methyl-8-(morpholin-4-ium-4-ylmethyl)-7-propylpurine-2,6-dione |
| SMILES | CCCn1c(C[NH+]2CCOCC2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C14H21N5O3/c1-3-4-19-10(9-18-5-7-22-8-6-18)15-12-11(19)13(20)16-14(21)17(12)2/h3-9H2,1-2H3,(H,16,20,21)/p+1 |
| InChIKey | UUNSOILUNAIDHK-UHFFFAOYSA-O |
| XLogP | -1.75 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |