C17H18ClFN4O3 — CID 9202738
3-butyl-8-[(2-chloro-4-fluorophenoxy)methyl]-7-methylpurine-2,6-dione (PubChem CID 9202738) has the molecular formula C17H18ClFN4O3 and a molecular weight of 380.81 g/mol. Its IUPAC name is 3-butyl-8-[(2-chloro-4-fluorophenoxy)methyl]-7-methylpurine-2,6-dione.
| Compound Name | 3-butyl-8-[(2-chloro-4-fluorophenoxy)methyl]-7-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 9202738 |
| Molecular Formula | C17H18ClFN4O3 |
| Molecular Weight | 380.81 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 3-butyl-8-[(2-chloro-4-fluorophenoxy)methyl]-7-methylpurine-2,6-dione |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COc1ccc(F)cc1Cl)n2C |
| InChI | InChI=1S/C17H18ClFN4O3/c1-3-4-7-23-15-14(16(24)21-17(23)25)22(2)13(20-15)9-26-12-6-5-10(19)8-11(12)18/h5-6,8H,3-4,7,9H2,1-2H3,(H,21,24,25) |
| InChIKey | MQTSOIGEWGMYDE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.81 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |