C23H30N4O6 — CID 55401162
(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 3-ethoxy-4-propoxybenzoate (PubChem CID 55401162) has the molecular formula C23H30N4O6 and a molecular weight of 458.52 g/mol. Its IUPAC name is (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 3-ethoxy-4-propoxybenzoate.
| Compound Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 3-ethoxy-4-propoxybenzoate |
|---|---|
| PubChem CID | 55401162 |
| Molecular Formula | C23H30N4O6 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 3-ethoxy-4-propoxybenzoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)c1ccc(OCCC)c(OCC)c1)n2C |
| InChI | InChI=1S/C23H30N4O6/c1-5-8-11-27-20-19(21(28)25-23(27)30)26(4)18(24-20)14-33-22(29)15-9-10-16(32-12-6-2)17(13-15)31-7-3/h9-10,13H,5-8,11-12,14H2,1-4H3,(H,25,28,30) |
| InChIKey | MYJIKGSKWMHPOE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |