C21H25N5O6S — CID 55403102
(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 4-(prop-2-enylsulfamoyl)benzoate (PubChem CID 55403102) has the molecular formula C21H25N5O6S and a molecular weight of 475.53 g/mol. Its IUPAC name is (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 4-(prop-2-enylsulfamoyl)benzoate.
| Compound Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 4-(prop-2-enylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55403102 |
| Molecular Formula | C21H25N5O6S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 4-(prop-2-enylsulfamoyl)benzoate |
| SMILES | C=CCNS(=O)(=O)c1ccc(C(=O)OCc2nc3c(c(=O)[nH]c(=O)n3CCCC)n2C)cc1 |
| InChI | InChI=1S/C21H25N5O6S/c1-4-6-12-26-18-17(19(27)24-21(26)29)25(3)16(23-18)13-32-20(28)14-7-9-15(10-8-14)33(30,31)22-11-5-2/h5,7-10,22H,2,4,6,11-13H2,1,3H3,(H,24,27,29) |
| InChIKey | APAXUBKRCNQIKT-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|