C26H34N4O6 — CID 55401008
(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 4-oxo-4-(4-pentoxyphenyl)butanoate (PubChem CID 55401008) has the molecular formula C26H34N4O6 and a molecular weight of 498.58 g/mol. Its IUPAC name is (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 4-oxo-4-(4-pentoxyphenyl)butanoate.
| Compound Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 4-oxo-4-(4-pentoxyphenyl)butanoate |
|---|---|
| PubChem CID | 55401008 |
| Molecular Formula | C26H34N4O6 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 4-oxo-4-(4-pentoxyphenyl)butanoate |
| SMILES | CCCCCOc1ccc(C(=O)CCC(=O)OCc2nc3c(c(=O)[nH]c(=O)n3CCCC)n2C)cc1 |
| InChI | InChI=1S/C26H34N4O6/c1-4-6-8-16-35-19-11-9-18(10-12-19)20(31)13-14-22(32)36-17-21-27-24-23(29(21)3)25(33)28-26(34)30(24)15-7-5-2/h9-12H,4-8,13-17H2,1-3H3,(H,28,33,34) |
| InChIKey | WAIBGBDKMYXCBQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|