C22H25N5O4 — CID 55398267
(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 3-(1H-indol-3-yl)propanoate (PubChem CID 55398267) has the molecular formula C22H25N5O4 and a molecular weight of 423.47 g/mol. Its IUPAC name is (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 3-(1H-indol-3-yl)propanoate.
| Compound Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 55398267 |
| Molecular Formula | C22H25N5O4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 3-(1H-indol-3-yl)propanoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)CCc1c[nH]c3ccccc13)n2C |
| InChI | InChI=1S/C22H25N5O4/c1-3-4-11-27-20-19(21(29)25-22(27)30)26(2)17(24-20)13-31-18(28)10-9-14-12-23-16-8-6-5-7-15(14)16/h5-8,12,23H,3-4,9-11,13H2,1-2H3,(H,25,29,30) |
| InChIKey | OYKGQFVZPLWHSX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 114.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |