C22H24N6O4 — CID 55528712
(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 2-(1-phenylpyrazol-4-yl)acetate (PubChem CID 55528712) has the molecular formula C22H24N6O4 and a molecular weight of 436.47 g/mol. Its IUPAC name is (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 2-(1-phenylpyrazol-4-yl)acetate.
| Compound Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 2-(1-phenylpyrazol-4-yl)acetate |
|---|---|
| PubChem CID | 55528712 |
| Molecular Formula | C22H24N6O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 2-(1-phenylpyrazol-4-yl)acetate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)Cc1cnn(-c3ccccc3)c1)n2C |
| InChI | InChI=1S/C22H24N6O4/c1-3-4-10-27-20-19(21(30)25-22(27)31)26(2)17(24-20)14-32-18(29)11-15-12-23-28(13-15)16-8-6-5-7-9-16/h5-9,12-13H,3-4,10-11,14H2,1-2H3,(H,25,30,31) |
| InChIKey | JRAVCEMSRYAUNH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 116.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |