C23H25N5O5 — CID 55449200
(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 2-(2-phenyl-1,3-oxazol-4-yl)acetate (PubChem CID 55449200) has the molecular formula C23H25N5O5 and a molecular weight of 451.48 g/mol. Its IUPAC name is (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 2-(2-phenyl-1,3-oxazol-4-yl)acetate.
| Compound Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 2-(2-phenyl-1,3-oxazol-4-yl)acetate |
|---|---|
| PubChem CID | 55449200 |
| Molecular Formula | C23H25N5O5 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 2-(2-phenyl-1,3-oxazol-4-yl)acetate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)Cc1coc(-c3ccccc3)n1)n2CC |
| InChI | InChI=1S/C23H25N5O5/c1-3-5-11-28-20-19(21(30)26-23(28)31)27(4-2)17(25-20)14-32-18(29)12-16-13-33-22(24-16)15-9-7-6-8-10-15/h6-10,13H,3-5,11-12,14H2,1-2H3,(H,26,30,31) |
| InChIKey | LYAGWHSFXHAAFM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |