C22H26N4O6 — CID 55471308
(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-(1,3-benzodioxol-5-yl)propanoate (PubChem CID 55471308) has the molecular formula C22H26N4O6 and a molecular weight of 442.47 g/mol. Its IUPAC name is (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-(1,3-benzodioxol-5-yl)propanoate.
| Compound Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-(1,3-benzodioxol-5-yl)propanoate |
|---|---|
| PubChem CID | 55471308 |
| Molecular Formula | C22H26N4O6 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-(1,3-benzodioxol-5-yl)propanoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)CCc1ccc3c(c1)OCO3)n2CC |
| InChI | InChI=1S/C22H26N4O6/c1-3-5-10-26-20-19(21(28)24-22(26)29)25(4-2)17(23-20)12-30-18(27)9-7-14-6-8-15-16(11-14)32-13-31-15/h6,8,11H,3-5,7,9-10,12-13H2,1-2H3,(H,24,28,29) |
| InChIKey | MIIRQNNYSICPSD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |