C23H26N6O6 — CID 45354625
8-[[4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]-3-butyl-7-ethylpurine-2,6-dione (PubChem CID 45354625) has the molecular formula C23H26N6O6 and a molecular weight of 482.50 g/mol. Its IUPAC name is 8-[[4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]-3-butyl-7-ethylpurine-2,6-dione.
| Compound Name | 8-[[4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]-3-butyl-7-ethylpurine-2,6-dione |
|---|---|
| PubChem CID | 45354625 |
| Molecular Formula | C23H26N6O6 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 8-[[4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]-3-butyl-7-ethylpurine-2,6-dione |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(CN1C(=O)NC(C)(c3ccc4c(c3)OCO4)C1=O)n2CC |
| InChI | InChI=1S/C23H26N6O6/c1-4-6-9-28-18-17(19(30)25-21(28)32)27(5-2)16(24-18)11-29-20(31)23(3,26-22(29)33)13-7-8-14-15(10-13)35-12-34-14/h7-8,10H,4-6,9,11-12H2,1-3H3,(H,26,33)(H,25,30,32) |
| InChIKey | QQFPIBKMDDZTGF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|