C20H27N5O2 — CID 51224438
3-butyl-8-[(2,5-dimethylanilino)methyl]-7-ethylpurine-2,6-dione (PubChem CID 51224438) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 3-butyl-8-[(2,5-dimethylanilino)methyl]-7-ethylpurine-2,6-dione.
| Compound Name | 3-butyl-8-[(2,5-dimethylanilino)methyl]-7-ethylpurine-2,6-dione |
|---|---|
| PubChem CID | 51224438 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 3-butyl-8-[(2,5-dimethylanilino)methyl]-7-ethylpurine-2,6-dione |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(CNc1cc(C)ccc1C)n2CC |
| InChI | InChI=1S/C20H27N5O2/c1-5-7-10-25-18-17(19(26)23-20(25)27)24(6-2)16(22-18)12-21-15-11-13(3)8-9-14(15)4/h8-9,11,21H,5-7,10,12H2,1-4H3,(H,23,26,27) |
| InChIKey | LOIMZAFXDILHEQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |