C22H30N6O3 — CID 112818547
N-[3-[1-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methylamino]ethyl]phenyl]acetamide (PubChem CID 112818547) has the molecular formula C22H30N6O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[3-[1-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methylamino]ethyl]phenyl]acetamide.
| Compound Name | N-[3-[1-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methylamino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 112818547 |
| Molecular Formula | C22H30N6O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | N-[3-[1-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methylamino]ethyl]phenyl]acetamide |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(CNC(C)c1cccc(NC(C)=O)c1)n2CC |
| InChI | InChI=1S/C22H30N6O3/c1-5-7-11-28-20-19(21(30)26-22(28)31)27(6-2)18(25-20)13-23-14(3)16-9-8-10-17(12-16)24-15(4)29/h8-10,12,14,23H,5-7,11,13H2,1-4H3,(H,24,29)(H,26,30,31) |
| InChIKey | ISOJKIMCHMGKQX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |