C19H24FN5O2 — CID 17463125
3-butyl-7-ethyl-8-[(5-fluoro-2-methylanilino)methyl]purine-2,6-dione (PubChem CID 17463125) has the molecular formula C19H24FN5O2 and a molecular weight of 373.43 g/mol. Its IUPAC name is 3-butyl-7-ethyl-8-[(5-fluoro-2-methylanilino)methyl]purine-2,6-dione.
| Compound Name | 3-butyl-7-ethyl-8-[(5-fluoro-2-methylanilino)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 17463125 |
| Molecular Formula | C19H24FN5O2 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 3-butyl-7-ethyl-8-[(5-fluoro-2-methylanilino)methyl]purine-2,6-dione |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(CNc1cc(F)ccc1C)n2CC |
| InChI | InChI=1S/C19H24FN5O2/c1-4-6-9-25-17-16(18(26)23-19(25)27)24(5-2)15(22-17)11-21-14-10-13(20)8-7-12(14)3/h7-8,10,21H,4-6,9,11H2,1-3H3,(H,23,26,27) |
| InChIKey | NRKAFTAPKFKXOW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |