C19H22N6O2 — CID 55409686
4-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methylamino]benzonitrile (PubChem CID 55409686) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is 4-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methylamino]benzonitrile.
| Compound Name | 4-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 55409686 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 4-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methylamino]benzonitrile |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(CNc1ccc(C#N)cc1)n2CC |
| InChI | InChI=1S/C19H22N6O2/c1-3-5-10-25-17-16(18(26)23-19(25)27)24(4-2)15(22-17)12-21-14-8-6-13(11-20)7-9-14/h6-9,21H,3-5,10,12H2,1-2H3,(H,23,26,27) |
| InChIKey | IJNVMMGONXOSNV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 108.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |