C19H20BrFN4O5 — CID 55400318
(3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 2-(4-bromo-2-fluorophenoxy)acetate (PubChem CID 55400318) has the molecular formula C19H20BrFN4O5 and a molecular weight of 483.29 g/mol. Its IUPAC name is (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 2-(4-bromo-2-fluorophenoxy)acetate.
| Compound Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 2-(4-bromo-2-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 55400318 |
| Molecular Formula | C19H20BrFN4O5 |
| Molecular Weight | 483.29 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | (3-butyl-7-methyl-2,6-dioxopurin-8-yl)methyl 2-(4-bromo-2-fluorophenoxy)acetate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)COc1ccc(Br)cc1F)n2C |
| InChI | InChI=1S/C19H20BrFN4O5/c1-3-4-7-25-17-16(18(27)23-19(25)28)24(2)14(22-17)9-30-15(26)10-29-13-6-5-11(20)8-12(13)21/h5-6,8H,3-4,7,9-10H2,1-2H3,(H,23,27,28) |
| InChIKey | INXMZFSHOLBMDM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |