C12H19N5O2 — CID 82464143
8-(1-aminoethyl)-3-butyl-7-methylpurine-2,6-dione (PubChem CID 82464143) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 8-(1-aminoethyl)-3-butyl-7-methylpurine-2,6-dione.
| Compound Name | 8-(1-aminoethyl)-3-butyl-7-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 82464143 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 8-(1-aminoethyl)-3-butyl-7-methylpurine-2,6-dione |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(C(C)N)n2C |
| InChI | InChI=1S/C12H19N5O2/c1-4-5-6-17-10-8(11(18)15-12(17)19)16(3)9(14-10)7(2)13/h7H,4-6,13H2,1-3H3,(H,15,18,19) |
| InChIKey | BJVVQQIBPFMLDE-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |