C9H7Cl2N3O2 — CID 114759819
5,6-dichloro-1-ethylpyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 114759819) has the molecular formula C9H7Cl2N3O2 and a molecular weight of 260.08 g/mol. Its IUPAC name is 5,6-dichloro-1-ethylpyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 5,6-dichloro-1-ethylpyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 114759819 |
| Molecular Formula | C9H7Cl2N3O2 |
| Molecular Weight | 260.08 g/mol |
| Exact Mass | 258.99 |
| IUPAC Name | 5,6-dichloro-1-ethylpyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | CCn1c(=O)[nH]c(=O)c2c(Cl)c(Cl)cnc21 |
| InChI | InChI=1S/C9H7Cl2N3O2/c1-2-14-7-5(8(15)13-9(14)16)6(11)4(10)3-12-7/h3H,2H2,1H3,(H,13,15,16) |
| InChIKey | JBXPAPYQHBNBPN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.08 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |