C15H12N4O4 — CID 17160078
1-ethyl-5-(3-nitrophenyl)pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 17160078) has the molecular formula C15H12N4O4 and a molecular weight of 312.29 g/mol. Its IUPAC name is 1-ethyl-5-(3-nitrophenyl)pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-ethyl-5-(3-nitrophenyl)pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 17160078 |
| Molecular Formula | C15H12N4O4 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 1-ethyl-5-(3-nitrophenyl)pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | CCn1c(=O)[nH]c(=O)c2c(-c3cccc([N+](=O)[O-])c3)ccnc21 |
| InChI | InChI=1S/C15H12N4O4/c1-2-18-13-12(14(20)17-15(18)21)11(6-7-16-13)9-4-3-5-10(8-9)19(22)23/h3-8H,2H2,1H3,(H,17,20,21) |
| InChIKey | PFYUIVAJDWEZKG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|