C23H21N5O4 — CID 167799062
3-benzyl-7-cyclopentyl-8-(3-nitrophenyl)purine-2,6-dione (PubChem CID 167799062) has the molecular formula C23H21N5O4 and a molecular weight of 431.45 g/mol. Its IUPAC name is 3-benzyl-7-cyclopentyl-8-(3-nitrophenyl)purine-2,6-dione.
| Compound Name | 3-benzyl-7-cyclopentyl-8-(3-nitrophenyl)purine-2,6-dione |
|---|---|
| PubChem CID | 167799062 |
| Molecular Formula | C23H21N5O4 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 3-benzyl-7-cyclopentyl-8-(3-nitrophenyl)purine-2,6-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccccc2)c2nc(-c3cccc([N+](=O)[O-])c3)n(C3CCCC3)c12 |
| InChI | InChI=1S/C23H21N5O4/c29-22-19-21(26(23(30)25-22)14-15-7-2-1-3-8-15)24-20(27(19)17-10-4-5-11-17)16-9-6-12-18(13-16)28(31)32/h1-3,6-9,12-13,17H,4-5,10-11,14H2,(H,25,29,30) |
| InChIKey | RDYWBEBPOJSPSN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|