C24H21N5O3 — CID 41106717
4-[3-benzyl-2,6-dioxo-7-[[(2S)-oxolan-2-yl]methyl]purin-8-yl]benzonitrile (PubChem CID 41106717) has the molecular formula C24H21N5O3 and a molecular weight of 427.46 g/mol. Its IUPAC name is 4-[3-benzyl-2,6-dioxo-7-[[(2S)-oxolan-2-yl]methyl]purin-8-yl]benzonitrile.
| Compound Name | 4-[3-benzyl-2,6-dioxo-7-[[(2S)-oxolan-2-yl]methyl]purin-8-yl]benzonitrile |
|---|---|
| PubChem CID | 41106717 |
| Molecular Formula | C24H21N5O3 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 4-[3-benzyl-2,6-dioxo-7-[[(2S)-oxolan-2-yl]methyl]purin-8-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2nc3c(c(=O)[nH]c(=O)n3Cc3ccccc3)n2C[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C24H21N5O3/c25-13-16-8-10-18(11-9-16)21-26-22-20(28(21)15-19-7-4-12-32-19)23(30)27-24(31)29(22)14-17-5-2-1-3-6-17/h1-3,5-6,8-11,19H,4,7,12,14-15H2,(H,27,30,31)/t19-/m0/s1 |
| InChIKey | KOFKLHYIDRQJKY-IBGZPJMESA-N |
| XLogP | 2.65 |
| TPSA | 105.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |