C27H24N4O4 — CID 166186470
3-benzyl-7-(oxolan-2-ylmethyl)-8-(5-phenylfuran-2-yl)purine-2,6-dione (PubChem CID 166186470) has the molecular formula C27H24N4O4 and a molecular weight of 468.51 g/mol. Its IUPAC name is 3-benzyl-7-(oxolan-2-ylmethyl)-8-(5-phenylfuran-2-yl)purine-2,6-dione.
| Compound Name | 3-benzyl-7-(oxolan-2-ylmethyl)-8-(5-phenylfuran-2-yl)purine-2,6-dione |
|---|---|
| PubChem CID | 166186470 |
| Molecular Formula | C27H24N4O4 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 3-benzyl-7-(oxolan-2-ylmethyl)-8-(5-phenylfuran-2-yl)purine-2,6-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccccc2)c2nc(-c3ccc(-c4ccccc4)o3)n(CC3CCCO3)c12 |
| InChI | InChI=1S/C27H24N4O4/c32-26-23-25(31(27(33)29-26)16-18-8-3-1-4-9-18)28-24(30(23)17-20-12-7-15-34-20)22-14-13-21(35-22)19-10-5-2-6-11-19/h1-6,8-11,13-14,20H,7,12,15-17H2,(H,29,32,33) |
| InChIKey | XQALJTIZJGRMJD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |