C23H16ClN5O5 — CID 3938268
3-benzyl-8-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-7-methylpurine-2,6-dione (PubChem CID 3938268) has the molecular formula C23H16ClN5O5 and a molecular weight of 477.86 g/mol. Its IUPAC name is 3-benzyl-8-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-7-methylpurine-2,6-dione.
| Compound Name | 3-benzyl-8-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-7-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 3938268 |
| Molecular Formula | C23H16ClN5O5 |
| Molecular Weight | 477.86 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 3-benzyl-8-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-7-methylpurine-2,6-dione |
| SMILES | Cn1c(-c2ccc(-c3ccc([N+](=O)[O-])cc3Cl)o2)nc2c1c(=O)[nH]c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C23H16ClN5O5/c1-27-19-21(28(23(31)26-22(19)30)12-13-5-3-2-4-6-13)25-20(27)18-10-9-17(34-18)15-8-7-14(29(32)33)11-16(15)24/h2-11H,12H2,1H3,(H,26,30,31) |
| InChIKey | UVROFDUUMMXXPH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 128.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.86 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|