C19H13Cl2N3O3 — CID 129161872
5,6-dichloro-2-(5-methylfuran-2-yl)-1-[(3-nitrophenyl)methyl]benzimidazole (PubChem CID 129161872) has the molecular formula C19H13Cl2N3O3 and a molecular weight of 402.24 g/mol. Its IUPAC name is 5,6-dichloro-2-(5-methylfuran-2-yl)-1-[(3-nitrophenyl)methyl]benzimidazole.
| Compound Name | 5,6-dichloro-2-(5-methylfuran-2-yl)-1-[(3-nitrophenyl)methyl]benzimidazole |
|---|---|
| PubChem CID | 129161872 |
| Molecular Formula | C19H13Cl2N3O3 |
| Molecular Weight | 402.24 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 5,6-dichloro-2-(5-methylfuran-2-yl)-1-[(3-nitrophenyl)methyl]benzimidazole |
| SMILES | Cc1ccc(-c2nc3cc(Cl)c(Cl)cc3n2Cc2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C19H13Cl2N3O3/c1-11-5-6-18(27-11)19-22-16-8-14(20)15(21)9-17(16)23(19)10-12-3-2-4-13(7-12)24(25)26/h2-9H,10H2,1H3 |
| InChIKey | VMINHDGKYZXZCV-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 74.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.24 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|