About [5-[5,6-dichloro-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid
[5-[5,6-dichloro-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid (PubChem CID 22459930) has the molecular formula C15H15Cl2N2O4P
and a molecular weight of 389.18 g/mol. Its IUPAC name is [5-[5,6-dichloro-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid.
Molecular Properties
| Compound Name | [5-[5,6-dichloro-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid |
| PubChem CID | 22459930 |
| Molecular Formula | C15H15Cl2N2O4P |
| Molecular Weight | 389.18 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | [5-[5,6-dichloro-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid |
| SMILES | CC(C)Cn1c(-c2ccc(P(=O)(O)O)o2)nc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C15H15Cl2N2O4P/c1-8(2)7-19-12-6-10(17)9(16)5-11(12)18-15(19)13-3-4-14(23-13)24(20,21)22/h3-6,8H,7H2,1-2H3,(H2,20,21,22) |
| InChIKey | ARNAHTBOORHLPG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.18 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [5-[5,6-dichloro-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[5,6-dichloro-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid?
The IUPAC name of [5-[5,6-dichloro-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid (CID 22459930) is [5-[5,6-dichloro-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid.
What is the SMILES notation for [5-[5,6-dichloro-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid?
The canonical SMILES for [5-[5,6-dichloro-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid is CC(C)Cn1c(-c2ccc(P(=O)(O)O)o2)nc2cc(Cl)c(Cl)cc21.
What is the InChIKey of [5-[5,6-dichloro-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid?
The InChIKey is ARNAHTBOORHLPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15Cl2N2O4P/c1-8(2)7-19-12-6-10(17)9(16)5-11(12)18-15(19)13-3-4-14(23-13)24(20,21)22/h3-6,8H,7H2,1-2H3,(H2,20,21,22).
What are the key properties of [5-[5,6-dichloro-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid?
[5-[5,6-dichloro-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid has a molecular weight of 389.18 g/mol, XLogP of 4.06, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[5,6-dichloro-1-(2-methylpropyl)benzimidazol-2-yl]furan-2-yl]phosphonic acid is sourced from PubChem (CID 22459930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).